C30H60O6Si2 — CID 101044245
[(2S,3E,6E,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-5-(2-trimethylsilylethoxymethoxy)trideca-3,6-dienyl] 2,2-dimethylpropanoate (PubChem CID 101044245) has the molecular formula C30H60O6Si2 and a molecular weight of 572.98 g/mol. Its IUPAC name is [(2S,3E,6E,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-5-(2-trimethylsilylethoxymethoxy)trideca-3,6-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3E,6E,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-5-(2-trimethylsilylethoxymethoxy)trideca-3,6-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101044245 |
| Molecular Formula | C30H60O6Si2 |
| Molecular Weight | 572.98 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | [(2S,3E,6E,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-5-(2-trimethylsilylethoxymethoxy)trideca-3,6-dienyl] 2,2-dimethylpropanoate |
| SMILES | CCCCC[C@H](/C=C/C(/C=C/[C@H](O)COC(=O)C(C)(C)C)OCOCC[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H60O6Si2/c1-13-14-15-16-27(36-38(11,12)30(5,6)7)20-19-26(35-24-33-21-22-37(8,9)10)18-17-25(31)23-34-28(32)29(2,3)4/h17-20,25-27,31H,13-16,21-24H2,1-12H3/b18-17+,20-19+/t25-,26?,27+/m0/s1 |
| InChIKey | APIBMQWCKMCNGJ-YPSRTSQMSA-N |
| XLogP | 7.72 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.98 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|