C20H40Br2O3Si2 — CID 101044260
(1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(dibromomethyl)cyclohex-2-en-1-ol (PubChem CID 101044260) has the molecular formula C20H40Br2O3Si2 and a molecular weight of 544.52 g/mol. Its IUPAC name is (1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(dibromomethyl)cyclohex-2-en-1-ol.
| Compound Name | (1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(dibromomethyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 101044260 |
| Molecular Formula | C20H40Br2O3Si2 |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | (1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(dibromomethyl)cyclohex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]1(O)C(Br)Br |
| InChI | InChI=1S/C20H40Br2O3Si2/c1-18(2,3)26(7,8)24-14-15-13-16(11-12-20(15,23)17(21)22)25-27(9,10)19(4,5)6/h13,16-17,23H,11-12,14H2,1-10H3/t16-,20-/m0/s1 |
| InChIKey | MBWUNYDXBOMNHG-JXFKEZNVSA-N |
| XLogP | 6.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|