C16H16N4O — CID 101044631
4-[5-[4-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-yl]aniline (PubChem CID 101044631) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-[5-[4-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-yl]aniline.
| Compound Name | 4-[5-[4-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-yl]aniline |
|---|---|
| PubChem CID | 101044631 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4-[5-[4-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-yl]aniline |
| SMILES | CN(C)c1ccc(-c2nnc(-c3ccc(N)cc3)o2)cc1 |
| InChI | InChI=1S/C16H16N4O/c1-20(2)14-9-5-12(6-10-14)16-19-18-15(21-16)11-3-7-13(17)8-4-11/h3-10H,17H2,1-2H3 |
| InChIKey | IISCPMBBMUXMPA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|