About 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole
5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole (PubChem CID 10104475) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole |
| PubChem CID | 10104475 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole |
| SMILES | CN1CCCC12CCN(c1ccno1)C2 |
| InChI | InChI=1S/C11H17N3O/c1-13-7-2-4-11(13)5-8-14(9-11)10-3-6-12-15-10/h3,6H,2,4-5,7-9H2,1H3 |
| InChIKey | LTWGYJZFUYQWRA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole?
The IUPAC name of 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole (CID 10104475) is 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole.
What is the SMILES notation for 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole?
The canonical SMILES for 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole is CN1CCCC12CCN(c1ccno1)C2.
What is the InChIKey of 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole?
The InChIKey is LTWGYJZFUYQWRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O/c1-13-7-2-4-11(13)5-8-14(9-11)10-3-6-12-15-10/h3,6H,2,4-5,7-9H2,1H3.
What are the key properties of 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole?
5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole has a molecular weight of 207.28 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methyl-1,7-diazaspiro[4.4]nonan-7-yl)-1,2-oxazole is sourced from PubChem (CID 10104475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).