C17H25IO4 — CID 101044900
4-[(3R,4Z,10E)-11-iodo-3-(methoxymethoxy)undeca-4,10-dienyl]-2H-furan-5-one (PubChem CID 101044900) has the molecular formula C17H25IO4 and a molecular weight of 420.29 g/mol. Its IUPAC name is 4-[(3R,4Z,10E)-11-iodo-3-(methoxymethoxy)undeca-4,10-dienyl]-2H-furan-5-one.
| Compound Name | 4-[(3R,4Z,10E)-11-iodo-3-(methoxymethoxy)undeca-4,10-dienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 101044900 |
| Molecular Formula | C17H25IO4 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 4-[(3R,4Z,10E)-11-iodo-3-(methoxymethoxy)undeca-4,10-dienyl]-2H-furan-5-one |
| SMILES | COCO[C@@H](/C=C\CCCC/C=C/I)CCC1=CCOC1=O |
| InChI | InChI=1S/C17H25IO4/c1-20-14-22-16(8-6-4-2-3-5-7-12-18)10-9-15-11-13-21-17(15)19/h6-8,11-12,16H,2-5,9-10,13-14H2,1H3/b8-6-,12-7+/t16-/m0/s1 |
| InChIKey | PQUFAUTXXFKHNA-ZPSUJLIESA-N |
| XLogP | 4.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|