C17H22O2S — CID 101045073
(1S,2E,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-propylidene-8-oxabicyclo[5.1.0]octane (PubChem CID 101045073) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is (1S,2E,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-propylidene-8-oxabicyclo[5.1.0]octane.
| Compound Name | (1S,2E,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-propylidene-8-oxabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 101045073 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (1S,2E,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-propylidene-8-oxabicyclo[5.1.0]octane |
| SMILES | CC/C=C1\C[C@H](S(=O)c2ccccc2)CC[C@H]2O[C@@]12C |
| InChI | InChI=1S/C17H22O2S/c1-3-7-13-12-15(10-11-16-17(13,2)19-16)20(18)14-8-5-4-6-9-14/h4-9,15-16H,3,10-12H2,1-2H3/b13-7+/t15-,16-,17+,20?/m1/s1 |
| InChIKey | UFMHMTBGLLMMIY-CAKMKQAKSA-N |
| XLogP | 3.84 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|