About bis(2-oxopropyl) hydrogen phosphate
bis(2-oxopropyl) hydrogen phosphate (PubChem CID 10104535) has the molecular formula C6H11O6P
and a molecular weight of 210.12 g/mol. Its IUPAC name is bis(2-oxopropyl) hydrogen phosphate.
Molecular Properties
| Compound Name | bis(2-oxopropyl) hydrogen phosphate |
| PubChem CID | 10104535 |
| Molecular Formula | C6H11O6P |
| Molecular Weight | 210.12 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | bis(2-oxopropyl) hydrogen phosphate |
| SMILES | CC(=O)COP(=O)(O)OCC(C)=O |
| InChI | InChI=1S/C6H11O6P/c1-5(7)3-11-13(9,10)12-4-6(2)8/h3-4H2,1-2H3,(H,9,10) |
| InChIKey | FQYUWLVYQAQOBL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.12 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-oxopropyl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-oxopropyl) hydrogen phosphate?
The IUPAC name of bis(2-oxopropyl) hydrogen phosphate (CID 10104535) is bis(2-oxopropyl) hydrogen phosphate.
What is the SMILES notation for bis(2-oxopropyl) hydrogen phosphate?
The canonical SMILES for bis(2-oxopropyl) hydrogen phosphate is CC(=O)COP(=O)(O)OCC(C)=O.
What is the InChIKey of bis(2-oxopropyl) hydrogen phosphate?
The InChIKey is FQYUWLVYQAQOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O6P/c1-5(7)3-11-13(9,10)12-4-6(2)8/h3-4H2,1-2H3,(H,9,10).
What are the key properties of bis(2-oxopropyl) hydrogen phosphate?
bis(2-oxopropyl) hydrogen phosphate has a molecular weight of 210.12 g/mol, XLogP of 0.30, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-oxopropyl) hydrogen phosphate is sourced from PubChem (CID 10104535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).