About methyl 3-amino-2,2-difluorododecanoate
methyl 3-amino-2,2-difluorododecanoate (PubChem CID 101045440) has the molecular formula C13H25F2NO2
and a molecular weight of 265.34 g/mol. Its IUPAC name is methyl 3-amino-2,2-difluorododecanoate.
Molecular Properties
| Compound Name | methyl 3-amino-2,2-difluorododecanoate |
| PubChem CID | 101045440 |
| Molecular Formula | C13H25F2NO2 |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | methyl 3-amino-2,2-difluorododecanoate |
| SMILES | CCCCCCCCCC(N)C(F)(F)C(=O)OC |
| InChI | InChI=1S/C13H25F2NO2/c1-3-4-5-6-7-8-9-10-11(16)13(14,15)12(17)18-2/h11H,3-10,16H2,1-2H3 |
| InChIKey | ISOWEQZBIGJMHX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-amino-2,2-difluorododecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-2,2-difluorododecanoate?
The IUPAC name of methyl 3-amino-2,2-difluorododecanoate (CID 101045440) is methyl 3-amino-2,2-difluorododecanoate.
What is the SMILES notation for methyl 3-amino-2,2-difluorododecanoate?
The canonical SMILES for methyl 3-amino-2,2-difluorododecanoate is CCCCCCCCCC(N)C(F)(F)C(=O)OC.
What is the InChIKey of methyl 3-amino-2,2-difluorododecanoate?
The InChIKey is ISOWEQZBIGJMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25F2NO2/c1-3-4-5-6-7-8-9-10-11(16)13(14,15)12(17)18-2/h11H,3-10,16H2,1-2H3.
What are the key properties of methyl 3-amino-2,2-difluorododecanoate?
methyl 3-amino-2,2-difluorododecanoate has a molecular weight of 265.34 g/mol, XLogP of 3.26, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-2,2-difluorododecanoate is sourced from PubChem (CID 101045440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).