About 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide
1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide (PubChem CID 10104575) has the molecular formula C7H9Cl2OP
and a molecular weight of 211.03 g/mol. Its IUPAC name is 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide.
Molecular Properties
| Compound Name | 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide |
| PubChem CID | 10104575 |
| Molecular Formula | C7H9Cl2OP |
| Molecular Weight | 211.03 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide |
| SMILES | CC1=CP(=O)(Cl)CC(C)=C1Cl |
| InChI | InChI=1S/C7H9Cl2OP/c1-5-3-11(9,10)4-6(2)7(5)8/h3H,4H2,1-2H3 |
| InChIKey | OXJDKJAIZHEEKQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.03 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide?
The IUPAC name of 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide (CID 10104575) is 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide.
What is the SMILES notation for 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide?
The canonical SMILES for 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide is CC1=CP(=O)(Cl)CC(C)=C1Cl.
What is the InChIKey of 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide?
The InChIKey is OXJDKJAIZHEEKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl2OP/c1-5-3-11(9,10)4-6(2)7(5)8/h3H,4H2,1-2H3.
What are the key properties of 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide?
1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide has a molecular weight of 211.03 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichloro-3,5-dimethyl-2H-1λ5-phosphinine 1-oxide is sourced from PubChem (CID 10104575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).