C11H20O8 — CID 101046546
methyl (3S)-4-hydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanoate (PubChem CID 101046546) has the molecular formula C11H20O8 and a molecular weight of 280.27 g/mol. Its IUPAC name is methyl (3S)-4-hydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanoate.
| Compound Name | methyl (3S)-4-hydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanoate |
|---|---|
| PubChem CID | 101046546 |
| Molecular Formula | C11H20O8 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl (3S)-4-hydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanoate |
| SMILES | COC(=O)C[C@@H](CO)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O8/c1-18-7(14)2-5(3-12)11-10(17)9(16)8(15)6(4-13)19-11/h5-6,8-13,15-17H,2-4H2,1H3/t5-,6+,8+,9-,10+,11-/m0/s1 |
| InChIKey | OSENGIQNOQNLRX-ILPXZUKPSA-N |
| XLogP | -3.00 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |