C9F13NO3S — CID 101047016
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethoxy]ethanesulfonyl fluoride (PubChem CID 101047016) has the molecular formula C9F13NO3S and a molecular weight of 449.14 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethoxy]ethanesulfonyl fluoride.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethoxy]ethanesulfonyl fluoride |
|---|---|
| PubChem CID | 101047016 |
| Molecular Formula | C9F13NO3S |
| Molecular Weight | 449.14 g/mol |
| Exact Mass | 448.94 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethoxy]ethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C9F13NO3S/c10-2-1(3(11)5(13)23-4(2)12)6(14,15)7(16,17)26-8(18,19)9(20,21)27(22,24)25 |
| InChIKey | ODVUYKFBVYQTLJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.14 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|