C36H49F3Si — CID 101047137
[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-trifluorosilane (PubChem CID 101047137) has the molecular formula C36H49F3Si and a molecular weight of 566.87 g/mol. Its IUPAC name is [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-trifluorosilane.
| Compound Name | [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-trifluorosilane |
|---|---|
| PubChem CID | 101047137 |
| Molecular Formula | C36H49F3Si |
| Molecular Weight | 566.87 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-trifluorosilane |
| SMILES | CC(C)c1cc(C(C)C)c(-c2cccc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2[Si](F)(F)F)c(C(C)C)c1 |
| InChI | InChI=1S/C36H49F3Si/c1-20(2)26-16-30(22(5)6)34(31(17-26)23(7)8)28-14-13-15-29(36(28)40(37,38)39)35-32(24(9)10)18-27(21(3)4)19-33(35)25(11)12/h13-25H,1-12H3 |
| InChIKey | PBHVEQPFDDBJEB-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.87 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|