C10H16O5 — CID 10104733
(6S,7S,10R)-6,7-dihydroxy-10-methyloxecane-2,4-dione (PubChem CID 10104733) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (6S,7S,10R)-6,7-dihydroxy-10-methyloxecane-2,4-dione.
| Compound Name | (6S,7S,10R)-6,7-dihydroxy-10-methyloxecane-2,4-dione |
|---|---|
| PubChem CID | 10104733 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (6S,7S,10R)-6,7-dihydroxy-10-methyloxecane-2,4-dione |
| SMILES | C[C@@H]1CC[C@H](O)[C@@H](O)CC(=O)CC(=O)O1 |
| InChI | InChI=1S/C10H16O5/c1-6-2-3-8(12)9(13)4-7(11)5-10(14)15-6/h6,8-9,12-13H,2-5H2,1H3/t6-,8+,9+/m1/s1 |
| InChIKey | BQLVCFSSBHZBCF-YEPSODPASA-N |
| XLogP | -0.22 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|