About methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate
methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate (PubChem CID 101047659) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate.
Molecular Properties
| Compound Name | methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate |
| PubChem CID | 101047659 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@]2(C=Nc3ccccc32)CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H20N2O3/c1-26-20(25)18-11-21(14-22-17-10-6-5-9-16(17)21)12-19(24)23(18)13-15-7-3-2-4-8-15/h2-10,14,18H,11-13H2,1H3/t18-,21-/m1/s1 |
| InChIKey | IFIBWHHLFPDDLI-WIYYLYMNSA-N |
| XLogP | 3.00 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate?
The IUPAC name of methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate (CID 101047659) is methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate.
What is the SMILES notation for methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate?
The canonical SMILES for methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate is COC(=O)[C@H]1C[C@]2(C=Nc3ccccc32)CC(=O)N1Cc1ccccc1.
What is the InChIKey of methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate?
The InChIKey is IFIBWHHLFPDDLI-WIYYLYMNSA-N. The full InChI is InChI=1S/C21H20N2O3/c1-26-20(25)18-11-21(14-22-17-10-6-5-9-16(17)21)12-19(24)23(18)13-15-7-3-2-4-8-15/h2-10,14,18H,11-13H2,1H3/t18-,21-/m1/s1.
What are the key properties of methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate?
methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate has a molecular weight of 348.40 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2'R,3S)-1'-benzyl-6'-oxospiro[indole-3,4'-piperidine]-2'-carboxylate is sourced from PubChem (CID 101047659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).