C12H20O4 — CID 101048042
(2R,3S,4S,5Z)-3,4-dihydroxy-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 101048042) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (2R,3S,4S,5Z)-3,4-dihydroxy-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,3S,4S,5Z)-3,4-dihydroxy-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 101048042 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (2R,3S,4S,5Z)-3,4-dihydroxy-2-propyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCC[C@H]1OC(=O)CCC/C=C\[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20O4/c1-2-6-10-12(15)9(13)7-4-3-5-8-11(14)16-10/h4,7,9-10,12-13,15H,2-3,5-6,8H2,1H3/b7-4-/t9-,10+,12-/m0/s1 |
| InChIKey | IZFXFVSOQMEZKB-RVUUCJLMSA-N |
| XLogP | 1.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|