C22H39N5O5 — CID 101048122
(2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]ethyl]pyrrolidine-2-carboxamide (PubChem CID 101048122) has the molecular formula C22H39N5O5 and a molecular weight of 453.58 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 101048122 |
| Molecular Formula | C22H39N5O5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | (2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]ethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)NCCNC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(C)=O)C(C)C |
| InChI | InChI=1S/C22H39N5O5/c1-13(2)12-17(25-15(5)28)20(30)23-9-10-24-21(31)18-8-7-11-27(18)22(32)19(14(3)4)26-16(6)29/h13-14,17-19H,7-12H2,1-6H3,(H,23,30)(H,24,31)(H,25,28)(H,26,29)/t17-,18-,19-/m0/s1 |
| InChIKey | VNMNPRHZLQKBLA-FHWLQOOXSA-N |
| XLogP | -0.08 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|