C22H48B2O4Si2 — CID 101048146
[1,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-trimethylsilylbutan-2-yl]-trimethylsilane (PubChem CID 101048146) has the molecular formula C22H48B2O4Si2 and a molecular weight of 454.42 g/mol. Its IUPAC name is [1,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-trimethylsilylbutan-2-yl]-trimethylsilane.
| Compound Name | [1,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-trimethylsilylbutan-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101048146 |
| Molecular Formula | C22H48B2O4Si2 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | [1,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-trimethylsilylbutan-2-yl]-trimethylsilane |
| SMILES | CC1(C)OB(CC(C(CB2OC(C)(C)C(C)(C)O2)[Si](C)(C)C)[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C22H48B2O4Si2/c1-19(2)20(3,4)26-23(25-19)15-17(29(9,10)11)18(30(12,13)14)16-24-27-21(5,6)22(7,8)28-24/h17-18H,15-16H2,1-14H3 |
| InChIKey | XDBZPNKGNMMBHL-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|