C17H16F4O3 — CID 101048885
(2R)-1-(4-phenylphenoxy)-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol (PubChem CID 101048885) has the molecular formula C17H16F4O3 and a molecular weight of 344.30 g/mol. Its IUPAC name is (2R)-1-(4-phenylphenoxy)-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol.
| Compound Name | (2R)-1-(4-phenylphenoxy)-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol |
|---|---|
| PubChem CID | 101048885 |
| Molecular Formula | C17H16F4O3 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (2R)-1-(4-phenylphenoxy)-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol |
| SMILES | O[C@H](COc1ccc(-c2ccccc2)cc1)COC(F)(F)C(F)F |
| InChI | InChI=1S/C17H16F4O3/c18-16(19)17(20,21)24-11-14(22)10-23-15-8-6-13(7-9-15)12-4-2-1-3-5-12/h1-9,14,16,22H,10-11H2/t14-/m1/s1 |
| InChIKey | SJCOIEGDEMGZRY-CQSZACIVSA-N |
| XLogP | 3.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|