C18H19N7+2 — CID 101049409
6,9,10,13,24-pentaza-3,16-diazoniapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(21),3(25),4,8,11(24),14,16(23),18(22),19-nonaene (PubChem CID 101049409) has the molecular formula C18H19N7+2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 6,9,10,13,24-pentaza-3,16-diazoniapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(21),3(25),4,8,11(24),14,16(23),18(22),19-nonaene.
| Compound Name | 6,9,10,13,24-pentaza-3,16-diazoniapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(21),3(25),4,8,11(24),14,16(23),18(22),19-nonaene |
|---|---|
| PubChem CID | 101049409 |
| Molecular Formula | C18H19N7+2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 6,9,10,13,24-pentaza-3,16-diazoniapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(21),3(25),4,8,11(24),14,16(23),18(22),19-nonaene |
| SMILES | c1cc2cc(c1)C[n+]1ccn(c1)Cc1nc(n[nH]1)Cn1cc[n+](c1)C2 |
| InChI | InChI=1S/C18H19N7/c1-2-15-8-16(3-1)10-23-5-7-25(14-23)12-18-19-17(20-21-18)11-24-6-4-22(9-15)13-24/h1-8,13-14H,9-12H2,(H,19,20,21)/q+2 |
| InChIKey | QOVVHDVSBJLIRF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 59.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|