C12H19NO2 — CID 101049795
(7aR,10S,11aS)-10-hydroxy-1,2,5,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-one (PubChem CID 101049795) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (7aR,10S,11aS)-10-hydroxy-1,2,5,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-one.
| Compound Name | (7aR,10S,11aS)-10-hydroxy-1,2,5,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-one |
|---|---|
| PubChem CID | 101049795 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (7aR,10S,11aS)-10-hydroxy-1,2,5,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-one |
| SMILES | O=C1CC[C@]23C[C@@H](O)CC[C@H]2CCCN13 |
| InChI | InChI=1S/C12H19NO2/c14-10-4-3-9-2-1-7-13-11(15)5-6-12(9,13)8-10/h9-10,14H,1-8H2/t9-,10+,12+/m1/s1 |
| InChIKey | QYRABVKCJSBNMB-SCVCMEIPSA-N |
| XLogP | 1.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |