C31H28F2O2 — CID 101050003
(4R,5R)-4,5-bis[fluoro(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 101050003) has the molecular formula C31H28F2O2 and a molecular weight of 470.56 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[fluoro(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4,5-bis[fluoro(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 101050003 |
| Molecular Formula | C31H28F2O2 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (4R,5R)-4,5-bis[fluoro(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@@H](C(F)(c2ccccc2)c2ccccc2)[C@H](C(F)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C31H28F2O2/c1-29(2)34-27(30(32,23-15-7-3-8-16-23)24-17-9-4-10-18-24)28(35-29)31(33,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27-28H,1-2H3/t27-,28-/m1/s1 |
| InChIKey | BQXDWECSCZVMKE-VSGBNLITSA-N |
| XLogP | 7.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |