About 2-benzylsulfanyl-4H-1,3-thiazol-5-one
2-benzylsulfanyl-4H-1,3-thiazol-5-one (PubChem CID 10105003) has the molecular formula C10H9NOS2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-benzylsulfanyl-4H-1,3-thiazol-5-one.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-4H-1,3-thiazol-5-one |
| PubChem CID | 10105003 |
| Molecular Formula | C10H9NOS2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 2-benzylsulfanyl-4H-1,3-thiazol-5-one |
| SMILES | O=C1CN=C(SCc2ccccc2)S1 |
| InChI | InChI=1S/C10H9NOS2/c12-9-6-11-10(14-9)13-7-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | MVGNWGIJENIVAV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylsulfanyl-4H-1,3-thiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-4H-1,3-thiazol-5-one?
The IUPAC name of 2-benzylsulfanyl-4H-1,3-thiazol-5-one (CID 10105003) is 2-benzylsulfanyl-4H-1,3-thiazol-5-one.
What is the SMILES notation for 2-benzylsulfanyl-4H-1,3-thiazol-5-one?
The canonical SMILES for 2-benzylsulfanyl-4H-1,3-thiazol-5-one is O=C1CN=C(SCc2ccccc2)S1.
What is the InChIKey of 2-benzylsulfanyl-4H-1,3-thiazol-5-one?
The InChIKey is MVGNWGIJENIVAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS2/c12-9-6-11-10(14-9)13-7-8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of 2-benzylsulfanyl-4H-1,3-thiazol-5-one?
2-benzylsulfanyl-4H-1,3-thiazol-5-one has a molecular weight of 223.32 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-4H-1,3-thiazol-5-one is sourced from PubChem (CID 10105003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).