C12H16O4 — CID 10105023
1-(2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)ethenyl acetate (PubChem CID 10105023) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-(2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)ethenyl acetate.
| Compound Name | 1-(2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)ethenyl acetate |
|---|---|
| PubChem CID | 10105023 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)ethenyl acetate |
| SMILES | C=C(OC(C)=O)C1=CCC2OC(C)(C)OC12 |
| InChI | InChI=1S/C12H16O4/c1-7(14-8(2)13)9-5-6-10-11(9)16-12(3,4)15-10/h5,10-11H,1,6H2,2-4H3 |
| InChIKey | SJBQNQBAWPSSEN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|