About [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane
[(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane (PubChem CID 101050309) has the molecular formula C20H37NO2Si
and a molecular weight of 351.61 g/mol. Its IUPAC name is [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane |
| PubChem CID | 101050309 |
| Molecular Formula | C20H37NO2Si |
| Molecular Weight | 351.61 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane |
| SMILES | C/C(=C\c1coc(C(C)(C)C)n1)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H37NO2Si/c1-14(2)24(15(3)4,16(5)6)23-12-17(7)11-18-13-22-19(21-18)20(8,9)10/h11,13-16H,12H2,1-10H3/b17-11+ |
| InChIKey | XWNVJYFWXRLJRP-GZTJUZNOSA-N |
| XLogP | 6.57 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane?
The IUPAC name of [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane (CID 101050309) is [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane.
What is the SMILES notation for [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane?
The canonical SMILES for [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane is C/C(=C\c1coc(C(C)(C)C)n1)CO[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane?
The InChIKey is XWNVJYFWXRLJRP-GZTJUZNOSA-N. The full InChI is InChI=1S/C20H37NO2Si/c1-14(2)24(15(3)4,16(5)6)23-12-17(7)11-18-13-22-19(21-18)20(8,9)10/h11,13-16H,12H2,1-10H3/b17-11+.
What are the key properties of [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane?
[(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane has a molecular weight of 351.61 g/mol, XLogP of 6.57, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-(2-tert-butyl-1,3-oxazol-4-yl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane is sourced from PubChem (CID 101050309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).