C16H26O5 — CID 101050361
[(3R,4R,5S,6S)-3-formyl-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]nonan-6-yl]methyl 2,2-dimethylpropanoate (PubChem CID 101050361) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-3-formyl-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]nonan-6-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3R,4R,5S,6S)-3-formyl-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]nonan-6-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101050361 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(3R,4R,5S,6S)-3-formyl-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]nonan-6-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C[C@@H]1[C@H]2OC(C)(CC[C@H]2COC(=O)C(C)(C)C)O[C@H]1C=O |
| InChI | InChI=1S/C16H26O5/c1-10-12(8-17)20-16(5)7-6-11(13(10)21-16)9-19-14(18)15(2,3)4/h8,10-13H,6-7,9H2,1-5H3/t10-,11-,12-,13+,16?/m0/s1 |
| InChIKey | OTZFOGGBQIETAM-CWPSZODZSA-N |
| XLogP | 2.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|