C20H33NO4Si — CID 101050527
(4aR,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile (PubChem CID 101050527) has the molecular formula C20H33NO4Si and a molecular weight of 379.57 g/mol. Its IUPAC name is (4aR,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile.
| Compound Name | (4aR,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile |
|---|---|
| PubChem CID | 101050527 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | (4aR,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile |
| SMILES | CO[C@H]1C(C)=C(O[Si](C)(C)C(C)(C)C)C[C@H]2OC(C)(C)CC(=O)[C@]21C#N |
| InChI | InChI=1S/C20H33NO4Si/c1-13-14(25-26(8,9)18(2,3)4)10-16-20(12-21,17(13)23-7)15(22)11-19(5,6)24-16/h16-17H,10-11H2,1-9H3/t16-,17+,20-/m1/s1 |
| InChIKey | QQOHHBAECORVCN-FUHIMQAGSA-N |
| XLogP | 4.35 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|