About 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one
3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one (PubChem CID 10105088) has the molecular formula C11H12ClNO2
and a molecular weight of 225.68 g/mol. Its IUPAC name is 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one.
Molecular Properties
| Compound Name | 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one |
| PubChem CID | 10105088 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCl)CO2 |
| InChI | InChI=1S/C11H12ClNO2/c1-8-2-3-10-9(6-8)11(14)13(5-4-12)7-15-10/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | XKBQPDWRWAYQGG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one?
The IUPAC name of 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one (CID 10105088) is 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one.
What is the SMILES notation for 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one?
The canonical SMILES for 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one is Cc1ccc2c(c1)C(=O)N(CCCl)CO2.
What is the InChIKey of 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one?
The InChIKey is XKBQPDWRWAYQGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO2/c1-8-2-3-10-9(6-8)11(14)13(5-4-12)7-15-10/h2-3,6H,4-5,7H2,1H3.
What are the key properties of 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one?
3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one has a molecular weight of 225.68 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloroethyl)-6-methyl-2H-1,3-benzoxazin-4-one is sourced from PubChem (CID 10105088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).