About 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline
2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline (PubChem CID 10105092) has the molecular formula C10H12BrN
and a molecular weight of 226.12 g/mol. Its IUPAC name is 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline.
Molecular Properties
| Compound Name | 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline |
| PubChem CID | 10105092 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline |
| SMILES | Cc1cc2c(nc1Br)CCCC2 |
| InChI | InChI=1S/C10H12BrN/c1-7-6-8-4-2-3-5-9(8)12-10(7)11/h6H,2-5H2,1H3 |
| InChIKey | VYNOGJDUYLENJV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline?
The IUPAC name of 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline (CID 10105092) is 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline.
What is the SMILES notation for 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline?
The canonical SMILES for 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline is Cc1cc2c(nc1Br)CCCC2.
What is the InChIKey of 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline?
The InChIKey is VYNOGJDUYLENJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN/c1-7-6-8-4-2-3-5-9(8)12-10(7)11/h6H,2-5H2,1H3.
What are the key properties of 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline?
2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline has a molecular weight of 226.12 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-methyl-5,6,7,8-tetrahydroquinoline is sourced from PubChem (CID 10105092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).