C13H15NO3 — CID 101051123
(3S,7S,7aS)-7-ethyl-3-phenyl-2,3,7,7a-tetrahydro-[1,3]oxazolo[3,2-c][1,3]oxazol-5-one (PubChem CID 101051123) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (3S,7S,7aS)-7-ethyl-3-phenyl-2,3,7,7a-tetrahydro-[1,3]oxazolo[3,2-c][1,3]oxazol-5-one.
| Compound Name | (3S,7S,7aS)-7-ethyl-3-phenyl-2,3,7,7a-tetrahydro-[1,3]oxazolo[3,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 101051123 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (3S,7S,7aS)-7-ethyl-3-phenyl-2,3,7,7a-tetrahydro-[1,3]oxazolo[3,2-c][1,3]oxazol-5-one |
| SMILES | CC[C@@H]1OC(=O)N2[C@@H](c3ccccc3)CO[C@@H]12 |
| InChI | InChI=1S/C13H15NO3/c1-2-11-12-14(13(15)17-11)10(8-16-12)9-6-4-3-5-7-9/h3-7,10-12H,2,8H2,1H3/t10-,11+,12+/m1/s1 |
| InChIKey | VJGDZIYGYGOVEQ-WOPDTQHZSA-N |
| XLogP | 2.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |