C9H13NO2 — CID 101051126
(1S,8aS)-1-ethyl-1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 101051126) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (1S,8aS)-1-ethyl-1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (1S,8aS)-1-ethyl-1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 101051126 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (1S,8aS)-1-ethyl-1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | CC[C@@H]1OC(=O)N2C=CCC[C@@H]12 |
| InChI | InChI=1S/C9H13NO2/c1-2-8-7-5-3-4-6-10(7)9(11)12-8/h4,6-8H,2-3,5H2,1H3/t7-,8-/m0/s1 |
| InChIKey | BKUMGRNTMDCOOD-YUMQZZPRSA-N |
| XLogP | 1.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |