C8H6F5NO — CID 10105131
4-methyl-6-(1,1,2,2,2-pentafluoroethyl)-1H-pyridin-2-one (PubChem CID 10105131) has the molecular formula C8H6F5NO and a molecular weight of 227.13 g/mol. Its IUPAC name is 4-methyl-6-(1,1,2,2,2-pentafluoroethyl)-1H-pyridin-2-one.
| Compound Name | 4-methyl-6-(1,1,2,2,2-pentafluoroethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 10105131 |
| Molecular Formula | C8H6F5NO |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 4-methyl-6-(1,1,2,2,2-pentafluoroethyl)-1H-pyridin-2-one |
| SMILES | Cc1cc(C(F)(F)C(F)(F)F)[nH]c(=O)c1 |
| InChI | InChI=1S/C8H6F5NO/c1-4-2-5(14-6(15)3-4)7(9,10)8(11,12)13/h2-3H,1H3,(H,14,15) |
| InChIKey | NWWMUUFRGVQFPK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|