About [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate
[(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate (PubChem CID 10105194) has the molecular formula C11H13ClO3
and a molecular weight of 228.67 g/mol. Its IUPAC name is [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate.
Molecular Properties
| Compound Name | [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate |
| PubChem CID | 10105194 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate |
| SMILES | C#CC1=C(C)[C@@H](OC(=O)CCl)C[C@@H](O)C1 |
| InChI | InChI=1S/C11H13ClO3/c1-3-8-4-9(13)5-10(7(8)2)15-11(14)6-12/h1,9-10,13H,4-6H2,2H3/t9-,10-/m0/s1 |
| InChIKey | XOHRHZPGUZKZMQ-UWVGGRQHSA-N |
| XLogP | 1.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate?
The IUPAC name of [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate (CID 10105194) is [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate.
What is the SMILES notation for [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate?
The canonical SMILES for [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate is C#CC1=C(C)[C@@H](OC(=O)CCl)C[C@@H](O)C1.
What is the InChIKey of [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate?
The InChIKey is XOHRHZPGUZKZMQ-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H13ClO3/c1-3-8-4-9(13)5-10(7(8)2)15-11(14)6-12/h1,9-10,13H,4-6H2,2H3/t9-,10-/m0/s1.
What are the key properties of [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate?
[(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate has a molecular weight of 228.67 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] 2-chloroacetate is sourced from PubChem (CID 10105194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).