About 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid
3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid (PubChem CID 101052005) has the molecular formula C10H12N2O6
and a molecular weight of 256.21 g/mol. Its IUPAC name is 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid |
| PubChem CID | 101052005 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid |
| SMILES | COc1cc2c(cc1OC)C(N)(C(=O)O)ON2O |
| InChI | InChI=1S/C10H12N2O6/c1-16-7-3-5-6(4-8(7)17-2)12(15)18-10(5,11)9(13)14/h3-4,15H,11H2,1-2H3,(H,13,14) |
| InChIKey | SMHJYDRGLJEUFW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid?
The IUPAC name of 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid (CID 101052005) is 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid.
What is the SMILES notation for 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid?
The canonical SMILES for 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid is COc1cc2c(cc1OC)C(N)(C(=O)O)ON2O.
What is the InChIKey of 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid?
The InChIKey is SMHJYDRGLJEUFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O6/c1-16-7-3-5-6(4-8(7)17-2)12(15)18-10(5,11)9(13)14/h3-4,15H,11H2,1-2H3,(H,13,14).
What are the key properties of 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid?
3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid has a molecular weight of 256.21 g/mol, XLogP of 0.04, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-hydroxy-5,6-dimethoxy-2,1-benzoxazole-3-carboxylic acid is sourced from PubChem (CID 101052005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).