C15H19NO — CID 10105225
(4aR,10bR)-4,8-dimethyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one (PubChem CID 10105225) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (4aR,10bR)-4,8-dimethyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one.
| Compound Name | (4aR,10bR)-4,8-dimethyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 10105225 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (4aR,10bR)-4,8-dimethyl-1,2,4a,5,6,10b-hexahydrobenzo[f]quinolin-3-one |
| SMILES | Cc1ccc2c(c1)CC[C@@H]1[C@@H]2CCC(=O)N1C |
| InChI | InChI=1S/C15H19NO/c1-10-3-5-12-11(9-10)4-7-14-13(12)6-8-15(17)16(14)2/h3,5,9,13-14H,4,6-8H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | XDOWUVXUVBBNIH-ZIAGYGMSSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |