C19H29NOSi — CID 101052285
(2R,3S)-3,4-dimethyl-2-phenyl-5-triethylsilyl-2,3-dihydro-1H-pyridin-6-one (PubChem CID 101052285) has the molecular formula C19H29NOSi and a molecular weight of 315.53 g/mol. Its IUPAC name is (2R,3S)-3,4-dimethyl-2-phenyl-5-triethylsilyl-2,3-dihydro-1H-pyridin-6-one.
| Compound Name | (2R,3S)-3,4-dimethyl-2-phenyl-5-triethylsilyl-2,3-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 101052285 |
| Molecular Formula | C19H29NOSi |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | (2R,3S)-3,4-dimethyl-2-phenyl-5-triethylsilyl-2,3-dihydro-1H-pyridin-6-one |
| SMILES | CC[Si](CC)(CC)C1=C(C)[C@H](C)[C@H](c2ccccc2)NC1=O |
| InChI | InChI=1S/C19H29NOSi/c1-6-22(7-2,8-3)18-15(5)14(4)17(20-19(18)21)16-12-10-9-11-13-16/h9-14,17H,6-8H2,1-5H3,(H,20,21)/t14-,17+/m0/s1 |
| InChIKey | URXVFORUYQXMBJ-WMLDXEAASA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|