About methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate
methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate (PubChem CID 10105253) has the molecular formula C14H14O3
and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate |
| PubChem CID | 10105253 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate |
| SMILES | C=C=CCOc1ccc(/C=C\C(=O)OC)cc1 |
| InChI | InChI=1S/C14H14O3/c1-3-4-11-17-13-8-5-12(6-9-13)7-10-14(15)16-2/h4-10H,1,11H2,2H3/b10-7- |
| InChIKey | LUTXPQCBZWHPTG-YFHOEESVSA-N |
| XLogP | 2.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate?
The IUPAC name of methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate (CID 10105253) is methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate.
What is the SMILES notation for methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate?
The canonical SMILES for methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate is C=C=CCOc1ccc(/C=C\C(=O)OC)cc1.
What is the InChIKey of methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate?
The InChIKey is LUTXPQCBZWHPTG-YFHOEESVSA-N. The full InChI is InChI=1S/C14H14O3/c1-3-4-11-17-13-8-5-12(6-9-13)7-10-14(15)16-2/h4-10H,1,11H2,2H3/b10-7-.
What are the key properties of methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate?
methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate has a molecular weight of 230.26 g/mol, XLogP of 2.59, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-3-(4-buta-2,3-dienoxyphenyl)prop-2-enoate is sourced from PubChem (CID 10105253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).