C28H44N2O3 — CID 101052828
(2,2,6,6-tetramethylpiperidin-1-yl) (E)-4-phenyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enoate (PubChem CID 101052828) has the molecular formula C28H44N2O3 and a molecular weight of 456.67 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-1-yl) (E)-4-phenyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-1-yl) (E)-4-phenyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enoate |
|---|---|
| PubChem CID | 101052828 |
| Molecular Formula | C28H44N2O3 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.34 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-1-yl) (E)-4-phenyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enoate |
| SMILES | CC1(C)CCCC(C)(C)N1OC(=O)/C=C/C(ON1C(C)(C)CCCC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H44N2O3/c1-25(2)18-12-19-26(3,4)29(25)32-23(22-14-10-9-11-15-22)16-17-24(31)33-30-27(5,6)20-13-21-28(30,7)8/h9-11,14-17,23H,12-13,18-21H2,1-8H3/b17-16+ |
| InChIKey | BAZZEYUWBMXAGV-WUKNDPDISA-N |
| XLogP | 6.76 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|