C23H26N2O3 — CID 101052918
prop-2-enyl (3S,6R,7aS)-1-benzyl-6-methyl-3-phenyl-2,3,7,7a-tetrahydroimidazo[1,2-b][1,2]oxazole-6-carboxylate (PubChem CID 101052918) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is prop-2-enyl (3S,6R,7aS)-1-benzyl-6-methyl-3-phenyl-2,3,7,7a-tetrahydroimidazo[1,2-b][1,2]oxazole-6-carboxylate.
| Compound Name | prop-2-enyl (3S,6R,7aS)-1-benzyl-6-methyl-3-phenyl-2,3,7,7a-tetrahydroimidazo[1,2-b][1,2]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 101052918 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | prop-2-enyl (3S,6R,7aS)-1-benzyl-6-methyl-3-phenyl-2,3,7,7a-tetrahydroimidazo[1,2-b][1,2]oxazole-6-carboxylate |
| SMILES | C=CCOC(=O)[C@@]1(C)C[C@H]2N(Cc3ccccc3)C[C@H](c3ccccc3)N2O1 |
| InChI | InChI=1S/C23H26N2O3/c1-3-14-27-22(26)23(2)15-21-24(16-18-10-6-4-7-11-18)17-20(25(21)28-23)19-12-8-5-9-13-19/h3-13,20-21H,1,14-17H2,2H3/t20-,21+,23-/m1/s1 |
| InChIKey | VINBLSZTJCJISY-FUPPJEDESA-N |
| XLogP | 3.69 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|