C20H27NO4S — CID 101053015
methyl (2R,4S)-4-(3-methylidenehept-1-en-2-yl)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylate (PubChem CID 101053015) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is methyl (2R,4S)-4-(3-methylidenehept-1-en-2-yl)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylate.
| Compound Name | methyl (2R,4S)-4-(3-methylidenehept-1-en-2-yl)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 101053015 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | methyl (2R,4S)-4-(3-methylidenehept-1-en-2-yl)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylate |
| SMILES | C=C(CCCC)C(=C)[C@@H]1C[C@H](C(=O)OC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H27NO4S/c1-6-7-8-15(3)16(4)18-13-19(20(22)25-5)21(18)26(23,24)17-11-9-14(2)10-12-17/h9-12,18-19H,3-4,6-8,13H2,1-2,5H3/t18-,19+/m0/s1 |
| InChIKey | QHOFPCFKQYZEQP-RBUKOAKNSA-N |
| XLogP | 3.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|