C17H21NO5S — CID 101053119
ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-2-[(1R)-2-oxocyclohex-3-en-1-yl]acetate (PubChem CID 101053119) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-2-[(1R)-2-oxocyclohex-3-en-1-yl]acetate.
| Compound Name | ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-2-[(1R)-2-oxocyclohex-3-en-1-yl]acetate |
|---|---|
| PubChem CID | 101053119 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-2-[(1R)-2-oxocyclohex-3-en-1-yl]acetate |
| SMILES | CCOC(=O)[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@H]1CCC=CC1=O |
| InChI | InChI=1S/C17H21NO5S/c1-3-23-17(20)16(14-6-4-5-7-15(14)19)18-24(21,22)13-10-8-12(2)9-11-13/h5,7-11,14,16,18H,3-4,6H2,1-2H3/t14-,16-/m0/s1 |
| InChIKey | QYEHWXOBLRTKBL-HOCLYGCPSA-N |
| XLogP | 1.74 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |