C7H2F6O2 — CID 10105319
(5Z)-5-(1,2,2,3,3,3-hexafluoropropylidene)furan-2-one (PubChem CID 10105319) has the molecular formula C7H2F6O2 and a molecular weight of 232.08 g/mol. Its IUPAC name is (5Z)-5-(1,2,2,3,3,3-hexafluoropropylidene)furan-2-one.
| Compound Name | (5Z)-5-(1,2,2,3,3,3-hexafluoropropylidene)furan-2-one |
|---|---|
| PubChem CID | 10105319 |
| Molecular Formula | C7H2F6O2 |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | (5Z)-5-(1,2,2,3,3,3-hexafluoropropylidene)furan-2-one |
| SMILES | O=C1C=C/C(=C(/F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C7H2F6O2/c8-5(3-1-2-4(14)15-3)6(9,10)7(11,12)13/h1-2H/b5-3- |
| InChIKey | ZDALNPCIJRBBQU-HYXAFXHYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|