C11H8F4O — CID 10105321
2-methyl-4-(2,3,5,6-tetrafluorophenyl)but-3-yn-2-ol (PubChem CID 10105321) has the molecular formula C11H8F4O and a molecular weight of 232.18 g/mol. Its IUPAC name is 2-methyl-4-(2,3,5,6-tetrafluorophenyl)but-3-yn-2-ol.
| Compound Name | 2-methyl-4-(2,3,5,6-tetrafluorophenyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 10105321 |
| Molecular Formula | C11H8F4O |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-methyl-4-(2,3,5,6-tetrafluorophenyl)but-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H8F4O/c1-11(2,16)4-3-6-9(14)7(12)5-8(13)10(6)15/h5,16H,1-2H3 |
| InChIKey | RPHFHGRZJQGAJT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|