C15H24N2O5S — CID 101053354
(2S,3R)-2-(tert-butylsulfonylamino)-3-hydroxy-N-methoxy-N-methyl-3-phenylpropanamide (PubChem CID 101053354) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is (2S,3R)-2-(tert-butylsulfonylamino)-3-hydroxy-N-methoxy-N-methyl-3-phenylpropanamide.
| Compound Name | (2S,3R)-2-(tert-butylsulfonylamino)-3-hydroxy-N-methoxy-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 101053354 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2S,3R)-2-(tert-butylsulfonylamino)-3-hydroxy-N-methoxy-N-methyl-3-phenylpropanamide |
| SMILES | CON(C)C(=O)[C@@H](NS(=O)(=O)C(C)(C)C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O5S/c1-15(2,3)23(20,21)16-12(14(19)17(4)22-5)13(18)11-9-7-6-8-10-11/h6-10,12-13,16,18H,1-5H3/t12-,13+/m0/s1 |
| InChIKey | VOZZLLLZZYNHOH-QWHCGFSZSA-N |
| XLogP | 0.83 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|