About (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine
(2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine (PubChem CID 101053361) has the molecular formula C10H21NO2S
and a molecular weight of 219.35 g/mol. Its IUPAC name is (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine.
Molecular Properties
| Compound Name | (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine |
| PubChem CID | 101053361 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine |
| SMILES | CC[C@@H]1[C@@H](CC)N1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C10H21NO2S/c1-6-8-9(7-2)11(8)14(12,13)10(3,4)5/h8-9H,6-7H2,1-5H3/t8-,9-/m1/s1 |
| InChIKey | LHIXBDWGDODYSR-RKDXNWHRSA-N |
| XLogP | 1.99 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine?
The IUPAC name of (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine (CID 101053361) is (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine.
What is the SMILES notation for (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine?
The canonical SMILES for (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine is CC[C@@H]1[C@@H](CC)N1S(=O)(=O)C(C)(C)C.
What is the InChIKey of (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine?
The InChIKey is LHIXBDWGDODYSR-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H21NO2S/c1-6-8-9(7-2)11(8)14(12,13)10(3,4)5/h8-9H,6-7H2,1-5H3/t8-,9-/m1/s1.
What are the key properties of (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine?
(2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine has a molecular weight of 219.35 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-1-tert-butylsulfonyl-2,3-diethylaziridine is sourced from PubChem (CID 101053361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).