C30H46N4O2 — CID 101053474
(5S)-5-[8-[[(5S)-7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinolin-5-yl]amino]octylamino]-7,7-dimethyl-1,5,6,8-tetrahydroquinolin-2-one (PubChem CID 101053474) has the molecular formula C30H46N4O2 and a molecular weight of 494.72 g/mol. Its IUPAC name is (5S)-5-[8-[[(5S)-7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinolin-5-yl]amino]octylamino]-7,7-dimethyl-1,5,6,8-tetrahydroquinolin-2-one.
| Compound Name | (5S)-5-[8-[[(5S)-7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinolin-5-yl]amino]octylamino]-7,7-dimethyl-1,5,6,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 101053474 |
| Molecular Formula | C30H46N4O2 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | (5S)-5-[8-[[(5S)-7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinolin-5-yl]amino]octylamino]-7,7-dimethyl-1,5,6,8-tetrahydroquinolin-2-one |
| SMILES | CC1(C)Cc2[nH]c(=O)ccc2[C@@H](NCCCCCCCCN[C@H]2CC(C)(C)Cc3[nH]c(=O)ccc32)C1 |
| InChI | InChI=1S/C30H46N4O2/c1-29(2)17-23(21-11-13-27(35)33-25(21)19-29)31-15-9-7-5-6-8-10-16-32-24-18-30(3,4)20-26-22(24)12-14-28(36)34-26/h11-14,23-24,31-32H,5-10,15-20H2,1-4H3,(H,33,35)(H,34,36)/t23-,24-/m0/s1 |
| InChIKey | KAMWMSGUVVBPQB-ZEQRLZLVSA-N |
| XLogP | 5.31 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|