C16H24O2 — CID 101053785
(6S,10R)-6,10-bis(prop-2-enyl)spiro[4.5]dec-2-ene-6,10-diol (PubChem CID 101053785) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (6S,10R)-6,10-bis(prop-2-enyl)spiro[4.5]dec-2-ene-6,10-diol.
| Compound Name | (6S,10R)-6,10-bis(prop-2-enyl)spiro[4.5]dec-2-ene-6,10-diol |
|---|---|
| PubChem CID | 101053785 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (6S,10R)-6,10-bis(prop-2-enyl)spiro[4.5]dec-2-ene-6,10-diol |
| SMILES | C=CC[C@@]1(O)CCC[C@@](O)(CC=C)C12CC=CC2 |
| InChI | InChI=1S/C16H24O2/c1-3-8-15(17)12-7-13-16(18,9-4-2)14(15)10-5-6-11-14/h3-6,17-18H,1-2,7-13H2/t15-,16+ |
| InChIKey | VUYNBYFZCFLDRV-IYBDPMFKSA-N |
| XLogP | 3.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|