C27H36O9 — CID 101054276
4-O-[(1R)-1-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-methoxy-2-oxoethyl] 1-O-methyl butanedioate (PubChem CID 101054276) has the molecular formula C27H36O9 and a molecular weight of 504.58 g/mol. Its IUPAC name is 4-O-[(1R)-1-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-methoxy-2-oxoethyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[(1R)-1-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-methoxy-2-oxoethyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 101054276 |
| Molecular Formula | C27H36O9 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 4-O-[(1R)-1-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-methoxy-2-oxoethyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)O[C@@H](C(=O)OC)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C27H36O9/c1-25-11-9-16(28)13-15(25)5-6-17-18-10-12-27(33,26(18,2)14-19(29)22(17)25)23(24(32)35-4)36-21(31)8-7-20(30)34-3/h9,11,13,17-19,22-23,29,33H,5-8,10,12,14H2,1-4H3/t17-,18-,19-,22+,23-,25-,26-,27-/m0/s1 |
| InChIKey | QPYZKJJXEYHETJ-KMAWGYGDSA-N |
| XLogP | 2.03 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|