C16H28O9 — CID 101055263
ethyl (2S,4S,5R,6R)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(methoxymethoxy)methyl]-4,5-dihydroxyoxane-2-carboxylate (PubChem CID 101055263) has the molecular formula C16H28O9 and a molecular weight of 364.39 g/mol. Its IUPAC name is ethyl (2S,4S,5R,6R)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(methoxymethoxy)methyl]-4,5-dihydroxyoxane-2-carboxylate.
| Compound Name | ethyl (2S,4S,5R,6R)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(methoxymethoxy)methyl]-4,5-dihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 101055263 |
| Molecular Formula | C16H28O9 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | ethyl (2S,4S,5R,6R)-6-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(methoxymethoxy)methyl]-4,5-dihydroxyoxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](O)[C@@H](O)[C@H]([C@H](OCOC)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C16H28O9/c1-5-21-15(19)10-6-9(17)12(18)14(24-10)13(22-8-20-4)11-7-23-16(2,3)25-11/h9-14,17-18H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14+/m0/s1 |
| InChIKey | CILXPYUTAUNMCY-PRSXHHODSA-N |
| XLogP | -0.43 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|