About N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide
N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide (PubChem CID 101055439) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide.
Molecular Properties
| Compound Name | N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide |
| PubChem CID | 101055439 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide |
| SMILES | C=CCCN(C)C(=O)C1=CC(C)(C)CC1=O |
| InChI | InChI=1S/C13H19NO2/c1-5-6-7-14(4)12(16)10-8-13(2,3)9-11(10)15/h5,8H,1,6-7,9H2,2-4H3 |
| InChIKey | HSWDVZFIGCZHIB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide?
The IUPAC name of N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide (CID 101055439) is N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide.
What is the SMILES notation for N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide?
The canonical SMILES for N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide is C=CCCN(C)C(=O)C1=CC(C)(C)CC1=O.
What is the InChIKey of N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide?
The InChIKey is HSWDVZFIGCZHIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-5-6-7-14(4)12(16)10-8-13(2,3)9-11(10)15/h5,8H,1,6-7,9H2,2-4H3.
What are the key properties of N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide?
N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide has a molecular weight of 221.30 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-enyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide is sourced from PubChem (CID 101055439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).