C14H21NO2 — CID 101055448
6,6-dimethyl-2-pent-4-enyl-1,3a,5,6a-tetrahydrocyclopenta[c]pyrrole-3,4-dione (PubChem CID 101055448) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 6,6-dimethyl-2-pent-4-enyl-1,3a,5,6a-tetrahydrocyclopenta[c]pyrrole-3,4-dione.
| Compound Name | 6,6-dimethyl-2-pent-4-enyl-1,3a,5,6a-tetrahydrocyclopenta[c]pyrrole-3,4-dione |
|---|---|
| PubChem CID | 101055448 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 6,6-dimethyl-2-pent-4-enyl-1,3a,5,6a-tetrahydrocyclopenta[c]pyrrole-3,4-dione |
| SMILES | C=CCCCN1CC2C(C(=O)CC2(C)C)C1=O |
| InChI | InChI=1S/C14H21NO2/c1-4-5-6-7-15-9-10-12(13(15)17)11(16)8-14(10,2)3/h4,10,12H,1,5-9H2,2-3H3 |
| InChIKey | HFCRDHLQTCYCEA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|